On Target NS3_HCV1A 0.29411766/CHEMBL4106826
For the given ligand 2, we have found in our database that, being scored 0.29411766, the most similar ligand is CHEMBL4106826. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL4106826 (Similar Ligand) |
|---|---|
| CC1COc3c1c(=O)c(=O)c4c2CCCC(C)(C)c2ccc34 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc(COC(C)=O)cc2)c1F |
|
|
|
|
|
|
| 100d0000 01000800 01400302 00150301 22080011 0000c402 801001c0 10000401 05800940 00180a42 28102200 40009800 85028020 00a10000 42000026 0a08100a 00800604 02000100 0045e000 40000001 01500520 48020360 0100c020 00440014 01000400 88002301 00483008 c0806080 00404243 00220002 c6002024 02010400 | 00008040 00000800 00100100 42050600 00000211 00004010 20000000 01001000 00000900 00080e40 08100000 40008a00 02008864 00011004 00000000 0a080008 03020200 03000000 00000400 00000001 00000500 18028b20 01000000 10400014 00002400 a0002200 080c0000 40800081 00000280 00068002 c4040000 00020600 |