On Target PR_HIV1 0.17786561/CHEMBL494500
For the given ligand 2, we have found in our database that, being scored 0.17786561, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| CC1COc3c1c(=O)c(=O)c4c2CCCC(C)(C)c2ccc34 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 100d0000 01000800 01400302 00150301 22080011 0000c402 801001c0 10000401 05800940 00180a42 28102200 40009800 85028020 00a10000 42000026 0a08100a 00800604 02000100 0045e000 40000001 01500520 48020360 0100c020 00440014 01000400 88002301 00483008 c0806080 00404243 00220002 c6002024 02010400 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |