On Target NS5B_HCV1B 0.16666667/CHEMBL3645180
For the given ligand 4, we have found in our database that, being scored 0.16666667, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| 4 (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| COc1cc(/C=C/C(=O)O)ccc1O | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00000000 40000008 20000108 00010200 00001000 00000000 82000080 00000400 01800000 00000840 00000000 40108000 0400c002 00000000 01000003 00088008 00000400 02000000 00098018 00020200 00000000 08000a00 00000001 00400000 00001000 80000000 00422000 40000000 00400200 00020100 04000000 00000100 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |