On Target NS5B_HCV1B 0.22222222/CHEMBL3645202
For the given ligand 2, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| CC1COc3c1c(=O)c(=O)c4c2CCCC(C)(C)c2ccc34 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 100d0000 01000800 01400302 00150301 22080011 0000c402 801001c0 10000401 05800940 00180a42 28102200 40009800 85028020 00a10000 42000026 0a08100a 00800604 02000100 0045e000 40000001 01500520 48020360 0100c020 00440014 01000400 88002301 00483008 c0806080 00404243 00220002 c6002024 02010400 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |