On Target NA_INFB 0.33082706/CHEMBL183817
For the given ligand 1, we have found in our database that, being scored 0.33082706, the most similar ligand is CHEMBL183817. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL183817 (Similar Ligand) |
|---|---|
| O=C(/C=C/c1ccc(O)c(O)c1)OC2CC(O)(C(=O)O)CC(O)C2O | COC(=O)[C@@H]1C[C@H](C(=O)O)O[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00050000 41000008 20000500 00010300 00280040 00000000 82000080 00000400 01800000 01000840 40000000 4010d000 0c00802a 02800000 00000002 00089008 00820400 02000100 3341a018 00020201 00000020 08000a00 05000001 08400010 00001400 80000000 00422000 40000420 00400200 0002010a 04020000 00000010 | 00070040 01005000 00100000 80010500 003c00c0 00200000 00000000 20000000 00000000 01020080 00200000 4001d000 1400802a 03800000 00081008 18099008 10820000 80000100 11402000 00000201 00000020 10040e10 17000000 0810001c 10000400 00000000 00800200 10000021 00000200 00040001 00020000 00800a00 |