On Target NA_INFB 0.25454545/CHEMBL79499
For the given ligand 2, we have found in our database that, being scored 0.25454545, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| 2 (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| CC1COc3c1c(=O)c(=O)c4c2CCCC(C)(C)c2ccc34 | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 100d0000 01000800 01400302 00150301 22080011 0000c402 801001c0 10000401 05800940 00180a42 28102200 40009800 85028020 00a10000 42000026 0a08100a 00800604 02000100 0045e000 40000001 01500520 48020360 0100c020 00440014 01000400 88002301 00483008 c0806080 00404243 00220002 c6002024 02010400 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |