On Target NS3_HCV1A 0.22522523/CHEMBL4107639
For the given ligand 5, we have found in our database that, being scored 0.22522523, the most similar ligand is CHEMBL4107639. Check out the elaboration below.
| 5 (Given Ligand) | CHEMBL4107639 (Similar Ligand) |
|---|---|
| O=C(O)/C=C\c1ccc(O)c(O)c1 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2cccc(O)c2)c1F |
|
|
|
|
|
|
| 00000000 40000008 20000100 00010200 00000000 00000000 82000080 00000400 01800000 00000840 00000000 40108000 04008002 00000000 00000002 00088008 00000400 02000000 00018018 00020200 00000000 08000a00 00000001 00400000 00001000 80000000 00422000 40000000 00400000 00020100 04000000 00000000 | 00008040 42000808 20100100 02010600 00000201 00000010 22000000 01001000 00000800 00080e40 08100000 40008a00 02008866 00001004 00000000 28080008 03000200 03000000 00000400 00020201 00000500 18028300 01000000 10420014 00002000 a0000200 08040000 40800081 00000080 00068002 84040000 00020600 |