|
Name | 1 |
2D and 3D depictions | |
SMILES | CC15CC(O)C3CC1(OC2OC(CO)C(O)C(O)C2O)C3(COC(=O)c4ccccc4)C(=O)O5 |
Model downloads | |
Fingerprints |
Name | 3 |
2D and 3D depictions | |
SMILES | CC14CC3(O)OC(O1)C5(COC(=O)c2ccccc2)C3CC45OC7OC(COC(=O)c6ccccc6)C(O)C(O)C7O |
Model downloads | |
Fingerprints |
Name | 2 |
2D and 3D depictions | |
SMILES | O=c2cc(c1ccc(O)cc1)oc3cc(O)cc(O)c23 |
Model downloads | |
Fingerprints |
Name | 5 |
2D and 3D depictions | |
SMILES | O=C(O)/C=C\c1ccc(O)c(O)c1 |
Model downloads | |
Fingerprints |
Name | 4 |
2D and 3D depictions | |
SMILES | CCCC=c1oc(=O)c2ccccc12 |
Model downloads | |
Fingerprints |