On Target PA_INFA 0.33653846/CHEMBL1829211
For the given ligand 4, we have found in our database that, being scored 0.33653846, the most similar ligand is CHEMBL1829211. Check out the elaboration below.
| 4 (Given Ligand) | CHEMBL1829211 (Similar Ligand) |
|---|---|
| CCCC=c1oc(=O)c2ccccc12 | O=C(O)/C(O)=C/C(=O)c1ccc(-c2ccccc2)cc1 |
|
|
|
|
|
|
| 00280000 00010800 00000300 00010201 02000011 0800d000 80000080 00000400 00000100 40100840 08000000 40008800 80028000 00210000 02000002 02080008 00020400 02000200 00044000 00200001 00100000 08020b20 00208020 80400014 01000400 80002000 00483001 c0000000 00404200 00020000 c4000000 00000000 | 00002000 00000800 00000100 40010200 00000000 00800000 00000001 00000400 01000100 00980840 08000000 4000c800 80008000 00000000 00000000 00080008 00020400 02100000 04250010 10000800 00000000 18020a80 14008000 00400014 00001000 84004400 00400000 00000040 00004000 00020002 84000000 00000400 |