On Target NS5B_HCV1B 0.18981482/CHEMBL3645194
For the given ligand 4, we have found in our database that, being scored 0.18981482, the most similar ligand is CHEMBL3645194. Check out the elaboration below.
| 4 (Given Ligand) | CHEMBL3645194 (Similar Ligand) |
|---|---|
| CCCC=c1oc(=O)c2ccccc12 | CCN(c1cc2nn(-c3ccc(Cl)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00280000 00010800 00000300 00010201 02000011 0800d000 80000080 00000400 00000100 40100840 08000000 40008800 80028000 00210000 02000002 02080008 00020400 02000200 00044000 00200001 00100000 08020b20 00208020 80400014 01000400 80002000 00483001 c0000000 00404200 00020000 c4000000 00000000 | 0000c006 00805e08 20080902 41310e00 010c0000 00004042 02040000 02001408 00100900 000908c0 09312024 40118800 82008c27 01400201 800a0040 000e200c 04268000 02000604 08600008 00224201 c0100101 1c838f38 20800800 8360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |