On Target NP_HCoV-OC43 0.08163265/CHEMBL3233481
For the given ligand 1, we have found in our database that, being scored 0.08163265, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| 1 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC15CC(O)C3CC1(OC2OC(CO)C(O)C(O)C2O)C3(COC(=O)c4ccccc4)C(=O)O5 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00050040 01000800 00000508 00810300 803c0050 00204000 00002800 08000040 00202100 01000860 00040000 40009000 14008028 02810010 00080000 022a9008 00820000 02000000 1340a000 00000001 00100020 18020a20 05000000 08400014 00000400 80002000 00088000 24000020 00000200 0002000a c0a20000 02000000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |