On Target NS3_HCV1A 0.33333334/CHEMBL4107639
For the given ligand fghsfhsfh, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL4107639. Check out the elaboration below.
| fghsfhsfh (Given Ligand) | CHEMBL4107639 (Similar Ligand) |
|---|---|
| O=C(O)C(O)Cc1ccc(O)c(O)c1 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2cccc(O)c2)c1F |
|
|
|
|
|
|
| 00000000 42000008 20000100 00010200 00000041 40000000 02000000 00000000 00000800 00080840 08100000 4000d000 04008002 00000000 00040000 00088008 08000000 02000000 00400008 00020201 00000100 08000a00 05000040 00400010 00000800 80000000 00120000 00000000 00000000 00020002 00000000 00000400 | 00008040 42000808 20100100 02010600 00000201 00000010 22000000 01001000 00000800 00080e40 08100000 40008a00 02008866 00001004 00000000 28080008 03000200 03000000 00000400 00020201 00000500 18028300 01000000 10420014 00002000 a0000200 08040000 40800081 00000080 00068002 84040000 00020600 |