|
Name | ggggg |
2D and 3D depictions | |
SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC(Cc2ccc(O)c(O)c2)C(=O)O |
Model downloads | |
Fingerprints |
Name | fdagfh |
2D and 3D depictions | |
SMILES | O=c3cc(c1ccc(O)c(O)c1)oc4cc(O)cc(OC2OC(CO)C(O)C(O)C2O)c34 |
Model downloads | |
Fingerprints |
Name | fghsfhsfh |
2D and 3D depictions | |
SMILES | O=C(O)C(O)Cc1ccc(O)c(O)c1 |
Model downloads | |
Fingerprints |
Name | dfdggg |
2D and 3D depictions | |
SMILES | O=c3c(OC1OC(CO)C(O)C(O)C1O)c(c2ccc(O)c(O)c2)oc4cc(O)cc(O)c34 |
Model downloads | |
Fingerprints |
Name | dfgfgfg |
2D and 3D depictions | |
SMILES | CC5OC(OCC4OC(Oc3c(c1ccc(O)c(O)c1)oc2cc(O)cc(O)c2c3=O)C(O)C(O)C4O)C(O)C(O)C5O |
Model downloads | |
Fingerprints |