On Target ACE2_HUMAN 0.42708334/CHEMBL253224
For the given ligand fghsfhsfh, we have found in our database that, being scored 0.42708334, the most similar ligand is CHEMBL253224. Check out the elaboration below.
| fghsfhsfh (Given Ligand) | CHEMBL253224 (Similar Ligand) |
|---|---|
| O=C(O)C(O)Cc1ccc(O)c(O)c1 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 42000008 20000100 00010200 00000041 40000000 02000000 00000000 00000800 00080840 08100000 4000d000 04008002 00000000 00040000 00088008 08000000 02000000 00400008 00020201 00000100 08000a00 05000040 00400010 00000800 80000000 00120000 00000000 00000000 00020002 00000000 00000400 | 00010000 01005008 20100100 00110600 00000080 00000000 82000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10000000 02000000 00400008 00020201 00000100 18200e00 03000140 85500018 00000800 80000000 00120000 10000040 04000000 00060003 20004000 03012600 |