On Target PR_HIV1 0.24210526/CHEMBL510485
For the given ligand ggggg, we have found in our database that, being scored 0.24210526, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| ggggg (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| O=C(/C=C/c1ccc(O)c(O)c1)OC(Cc2ccc(O)c(O)c2)C(=O)O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 00040000 42000008 20000500 00010200 00000041 40000000 82000080 00000440 01800800 00080840 48100000 4010d080 0c008002 00000000 00040002 00088008 08020400 82000000 24418018 00020201 00010120 08000a00 05000041 08400014 00001c00 80000000 00522000 40000420 00400200 00020102 04000000 02000410 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |