On Target NS5B_HCV1A 0.36697248/CHEMBL446360
For the given ligand fghsfhsfh, we have found in our database that, being scored 0.36697248, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| fghsfhsfh (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| O=C(O)C(O)Cc1ccc(O)c(O)c1 | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00000000 42000008 20000100 00010200 00000041 40000000 02000000 00000000 00000800 00080840 08100000 4000d000 04008002 00000000 00040000 00088008 08000000 02000000 00400008 00020201 00000100 08000a00 05000040 00400010 00000800 80000000 00120000 00000000 00000000 00020002 00000000 00000400 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |