On Target NS5B_HCV1A 0.29850745/CHEMBL175894
For the given ligand ggggg, we have found in our database that, being scored 0.29850745, the most similar ligand is CHEMBL175894. Check out the elaboration below.
| ggggg (Given Ligand) | CHEMBL175894 (Similar Ligand) |
|---|---|
| O=C(/C=C/c1ccc(O)c(O)c1)OC(Cc2ccc(O)c(O)c2)C(=O)O | N#Cc1ccc(Br)cc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00040000 42000008 20000500 00010200 00000041 40000000 82000080 00000440 01800800 00080840 48100000 4010d080 0c008002 00000000 00040002 00088008 08020400 82000000 24418018 00020201 00010120 08000a00 05000041 08400014 00001c00 80000000 00522000 40000420 00400200 00020102 04000000 02000410 | 00056000 01008801 00000102 00010200 00080021 00000000 00000000 00000000 54100900 00880840 08100008 c001d000 04008010 00200000 20000000 08082008 00420000 02001000 04c00008 00008001 00000100 08020a00 11000480 00400014 00000800 80000080 00120000 00000041 10004002 00060402 80000008 08400400 |