On Target NS5B_HCV1B 0.19354838/CHEMBL4111989
For the given ligand ggggg, we have found in our database that, being scored 0.19354838, the most similar ligand is CHEMBL4111989. Check out the elaboration below.
| ggggg (Given Ligand) | CHEMBL4111989 (Similar Ligand) |
|---|---|
| O=C(/C=C/c1ccc(O)c(O)c1)OC(Cc2ccc(O)c(O)c2)C(=O)O | C[C@@]1(C#N)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1c1ccc2c(N)ncnn12 |
|
|
|
|
|
|
| 00040000 42000008 20000500 00010200 00000041 40000000 82000080 00000440 01800800 00080840 48100000 4010d080 0c008002 00000000 00040002 00088008 08020400 82000000 24418018 00020201 00010120 08000a00 05000041 08400014 00001c00 80000000 00522000 40000420 00400200 00020102 04000000 02000410 | 0000080a 81004009 e2401512 19010f20 050c8074 0012c024 0381c000 00200a80 1040cb00 010c0040 08108004 4a839040 00000802 02b30020 000e0040 020cba0c 094b8820 0680000e 01602008 00665203 40100121 2c008860 a5801cc6 08600110 40000400 80002102 060880c0 800508a0 0040020e 00c6cc16 41400280 6220ac82 |