On Target NSP15_SARS 0.15348837/CHEMBL221366
For the given ligand fdagfh, we have found in our database that, being scored 0.15348837, the most similar ligand is CHEMBL221366. Check out the elaboration below.
| fdagfh (Given Ligand) | CHEMBL221366 (Similar Ligand) |
|---|---|
| O=c3cc(c1ccc(O)c(O)c1)oc4cc(O)cc(OC2OC(CO)C(O)C(O)C2O)c34 | O=C(Oc1cccnc1)c1cccs1 |
|
|
|
|
|
|
| 04402041 41200018 28080108 00110300 80281240 82004820 42002800 40800200 02284100 41000860 40000010 41008000 40808412 02a00088 11200021 002ab208 00864040 02000840 1f48a200 00821a01 00340020 08000828 15200000 0a580010 08000400 80000000 040200b5 2c900060 51056200 01820800 40a00040 00010000 | 04010042 04000808 60004108 20000200 00041040 04004084 00080080 00200000 00000100 00000040 00000204 40048080 00808814 08010000 01032000 060c000c 09030000 02002008 00200000 00020010 40002060 48008a80 30900000 10c09004 02002400 04082000 00000200 80000004 00000200 00020000 c0000000 10c10000 |