On Target NSP15_SARS 0.14615385/CHEMBL2441741
For the given ligand dfgfgfg, we have found in our database that, being scored 0.14615385, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| dfgfgfg (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CC5OC(OCC4OC(Oc3c(c1ccc(O)c(O)c1)oc2cc(O)cc(O)c2c3=O)C(O)C(O)C4O)C(O)C(O)C5O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0c402041 41200018 20080108 01910300 803d124c 82004820 03042800 48802240 022a6110 41000860 40000090 41008010 40808412 02a00088 11200021 002ab208 00864040 22008840 1f48a200 00825a03 00340020 08000c28 15000000 0a584010 08400400 80000000 140a00b4 2c900068 01006300 11820a01 41e00240 02b50008 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |