On Target NP_HCoV-OC43 0.114893615/CHEMBL3233481
For the given ligand SCHEMBL17719237-RDRP, we have found in our database that, being scored 0.114893615, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| SCHEMBL17719237-RDRP (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| N#CC3(c1ccc2c(N)ncnn12)OC(COP(=O)(O)O)C(O)C3O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000000a 81004009 e2103512 19010f20 052c80f4 8000c004 0301c000 00200a00 10404b00 010c0040 08188004 42839040 00001802 02b30020 000e0040 020eaa0c 084b8820 06800004 01602008 00665203 40120120 3c008860 a5801cc6 08700110 00000400 80002000 0e0880c0 900108a0 0040020e 00c6cc16 41400280 22208c80 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |