Created at: Last updated at: Current status:
|
Name | AMP-NSP3 |
2D and 3D depictions | |
SMILES | Nc1ncnc2c1ncn2C3OC(COP(=O)(O)O)C(O)C3O |
Model downloads | |
Fingerprints |
Name | S-Adenosylmethionine-NSP16 |
2D and 3D depictions | |
SMILES | C[S+](CCC(N)C(=O)[O-])CC3OC(n2cnc1c(N)ncnc12)C(O)C3O |
Model downloads | |
Fingerprints |
Name | SCHEMBL17719237-RDRP |
2D and 3D depictions | |
SMILES | N#CC3(c1ccc2c(N)ncnn12)OC(COP(=O)(O)O)C(O)C3O |
Model downloads | |
Fingerprints |
Name | MLN-4760-ACE2 |
2D and 3D depictions | |
SMILES | CC(C)CC(NC(Cc1cncn1Cc2cc(Cl)cc(Cl)c2)C(=O)O)C(=O)O |
Model downloads | |
Fingerprints |
Name | GTPL10716-3CLPro |
2D and 3D depictions | |
SMILES | Cc3cc(C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=C\C(=O)OCc1ccccc1)C[C@@H]2CCNC2=O)C(C)C)no3 |
Model downloads | |
Fingerprints |