On Target PLP_SARS 0.2028302/CHEMBL213054
For the given ligand AMP-NSP3, we have found in our database that, being scored 0.2028302, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| AMP-NSP3 (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2C3OC(COP(=O)(O)O)C(O)C3O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000000a 01c01800 80080510 89090e20 003800e4 0000c000 0000cc00 00000800 00404100 018000b0 0c00800c 40019004 00001000 038a0120 00081080 101eca0c 002a0020 00000000 19c00000 80205003 80080020 14000850 27800040 0c000014 10000400 40000002 0e000200 10010070 00000208 00460014 c1680000 000080c0 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |