On Target NS3_HCV1A 0.26612905/CHEMBL4107993
For the given ligand XIE2008, we have found in our database that, being scored 0.26612905, the most similar ligand is CHEMBL4107993. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL4107993 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CC[C@@H](N)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 00000040 00000808 20100108 02010600 00001201 00020010 02040000 01001200 00000800 00088e40 08100000 40008200 00008842 00001000 01000001 08082008 03000200 02000000 00000400 00020001 00000100 18028200 01000000 12400014 00000000 e0000000 08320800 40800001 00000380 00068002 82040010 00000600 |