Created at: Last updated at: Current status:
|
Name | XIE2008 |
2D and 3D depictions | |
SMILES | CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 |
Model downloads | |
Fingerprints |
Name | XIE5-2-35 |
2D and 3D depictions | |
SMILES | Clc4ccc(COc2ccc(CNCc1ccccn1)cc2OCc3ccc(Cl)cc3)cc4 |
Model downloads | |
Fingerprints |
Name | XIE5-2-9 |
2D and 3D depictions | |
SMILES | CCN(CC)c4ccc(CNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3)cc4 |
Model downloads | |
Fingerprints |
Name | XIE5-2-17 |
2D and 3D depictions | |
SMILES | Fc4ccc(COc2ccc(CNCCCN1CCOCC1)cc2OCc3ccc(F)cc3)cc4 |
Model downloads | |
Fingerprints |