On Target ACE2_HUMAN 0.28301886/CHEMBL254495
For the given ligand XIE5-2-35, we have found in our database that, being scored 0.28301886, the most similar ligand is CHEMBL254495. Check out the elaboration below.
| XIE5-2-35 (Given Ligand) | CHEMBL254495 (Similar Ligand) |
|---|---|
| Clc4ccc(COc2ccc(CNCc1ccccn1)cc2OCc3ccc(Cl)cc3)cc4 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(OCc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 04008002 44000008 20004108 10210e00 00041020 00104000 02040000 02003001 00000100 00000840 00210004 40008800 02804886 00010080 01020401 020c810c 00002000 02000002 00680000 00020200 40000000 08008120 20800000 00c49000 00102000 c0002000 00260040 80000000 00000304 00060008 40040000 00024200 | 04010000 43005008 20100108 00110600 00001080 c0004000 82000000 20000004 00000980 020a08c0 08300000 4001b000 06808002 20050080 81080001 02080008 10000000 02000000 00480008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00000000 10000040 04000200 00060003 60004000 03012600 |