On Target ACE2_HUMAN 0.3951613/CHEMBL254703
For the given ligand XIE2008, we have found in our database that, being scored 0.3951613, the most similar ligand is CHEMBL254703. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL254703 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 04010000 01005008 20100108 00110600 00001080 00004000 82040000 20000004 00000980 020a08c0 08300000 4001b000 06808002 00050000 81080001 02080008 10000000 02000000 00400008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00120000 10000040 04000200 00060003 60004000 03012600 |