On Target PA_INFA 0.28244275/CHEMBL3600948
For the given ligand XIE5-2-35, we have found in our database that, being scored 0.28244275, the most similar ligand is CHEMBL3600948. Check out the elaboration below.
| XIE5-2-35 (Given Ligand) | CHEMBL3600948 (Similar Ligand) |
|---|---|
| Clc4ccc(COc2ccc(CNCc1ccccn1)cc2OCc3ccc(Cl)cc3)cc4 | Oc1ccc(/C=N/Nc2ccc(Cl)cc2)c(O)c1O |
|
|
|
|
|
|
| 04008002 44000008 20004108 10210e00 00041020 00104000 02040000 02003001 00000100 00000840 00210004 40008800 02804886 00010080 01020401 020c810c 00002000 02000002 00680000 00020200 40000000 08008120 20800000 00c49000 00102000 c0002000 00260040 80000000 00000304 00060008 40040000 00024200 | 0000a00b 40000008 20000100 00030200 00404000 04000000 02000000 01004000 00000100 00000841 00000004 40008800 82000006 00000000 00010040 0008e008 00000000 12000000 00000400 00220a00 40080000 0c000100 70040802 00600000 00002000 80000800 400a0000 00000000 00000008 000e0200 40000000 04020000 |