On Target PA_INFA 0.33333334/CHEMBL3600947
For the given ligand XIE2008, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |