On Target RT_HIV1 0.2421875/CHEMBL4226544
For the given ligand XIE2008, we have found in our database that, being scored 0.2421875, the most similar ligand is CHEMBL4226544. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL4226544 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | C=C(C)[C@@H]1CC[C@]2(CNCCCO)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 00000000 01000800 00100302 40050600 00000000 00004000 80000080 20000402 00000900 001808c0 08300000 40018800 00028002 00200000 00000402 00080008 00000400 02000020 02812000 00000201 01000100 18020a30 010080a0 00500014 01200001 80000000 00406000 d0000000 00400002 01060002 e4020000 00002600 |