On Target NS5B_HCV1A 0.25874126/CHEMBL348944
For the given ligand XIE2008, we have found in our database that, being scored 0.25874126, the most similar ligand is CHEMBL348944. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL348944 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CCC(C)[C@H](NC(=O)OCc1ccc(C(=O)O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 01010000 01403800 00100100 44050600 00081000 0001c000 00000000 20000008 04800300 000008c0 00200000 4001f000 0e008002 00012001 80000000 021a0408 000a0000 02080401 00c00890 00000201 00000000 38160e70 01000083 0250001c 00001001 80002082 00000060 90200020 08000200 02060001 e0004000 00002200 |