On Target NS5B_HCV1B 0.30392158/CHEMBL3645194
For the given ligand XIE5-2-9, we have found in our database that, being scored 0.30392158, the most similar ligand is CHEMBL3645194. Check out the elaboration below.
| XIE5-2-9 (Given Ligand) | CHEMBL3645194 (Similar Ligand) |
|---|---|
| CCN(CC)c4ccc(CNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3)cc4 | CCN(c1cc2nn(-c3ccc(Cl)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 0400c002 44000808 20000108 80210600 00001000 00004000 02040000 02001000 00000100 00000840 00200004 40008800 02804886 00018080 01000441 02088008 00042000 02000000 08480000 00020200 40100000 08008120 20000000 00c49000 00002000 c0002000 00260000 80000080 00008300 00060008 40040000 00020200 | 0000c006 00805e08 20080902 41310e00 010c0000 00004042 02040000 02001408 00100900 000908c0 09312024 40118800 82008c27 01400201 800a0040 000e200c 04268000 02000604 08600008 00224201 c0100101 1c838f38 20800800 8360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |