On Target NA_INFB 0.20472442/CHEMBL369125
For the given ligand XIE2008, we have found in our database that, being scored 0.20472442, the most similar ligand is CHEMBL369125. Check out the elaboration below.
| XIE2008 (Given Ligand) | CHEMBL369125 (Similar Ligand) |
|---|---|
| CC(C)NCC(O)COc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | COC(=O)[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 04000001 00000008 20100108 00210600 00001080 02004000 42000000 00000000 00000100 00000840 00200000 40008000 00804002 00010000 01200001 0208a008 10200000 02000004 00c00000 00020a00 00000000 18000020 07000080 08c01010 00000001 80002000 00080000 00800000 00010200 00060008 40000000 02000240 | 00030000 01003000 00100100 04010500 00180080 00000010 00000000 20000008 00000000 00020080 00200000 4001b000 0e00803a 03802001 80180000 00080008 10a20000 00000000 00c02010 00000201 00000000 30040e30 03000081 02100018 00001001 00000000 00000200 10000000 08000200 00040001 00024000 00802a00 |