On Target NP_HCoV-OC43 0.19259259/CHEMBL3233481
For the given ligand XIE5-2-35, we have found in our database that, being scored 0.19259259, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| XIE5-2-35 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Clc4ccc(COc2ccc(CNCc1ccccn1)cc2OCc3ccc(Cl)cc3)cc4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04008002 44000008 20004108 10210e00 00041020 00104000 02040000 02003001 00000100 00000840 00210004 40008800 02804886 00010080 01020401 020c810c 00002000 02000002 00680000 00020200 40000000 08008120 20800000 00c49000 00102000 c0002000 00260040 80000000 00000304 00060008 40040000 00024200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |