On Target NP_HCoV-OC43 0.11764706/CHEMBL3233481
For the given ligand XIE5-2-17, we have found in our database that, being scored 0.11764706, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| XIE5-2-17 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCCCN1CCOCC1)cc2OCc3ccc(F)cc3)cc4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04000000 44000408 20100108 82210600 00001080 00004010 02040000 02001000 00000100 00000960 00200000 40008000 00804802 00011080 01081409 02088108 10000000 02000200 00480000 00120200 00000000 18008020 12000000 00c49010 00000400 c0002000 00220000 80000001 00000300 00068018 60040000 00000200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |