On Target PLP_SARS 0.44360903/CHEMBL222735
For the given ligand XIE5-2-35, we have found in our database that, being scored 0.44360903, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| XIE5-2-35 (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| Clc4ccc(COc2ccc(CNCc1ccccn1)cc2OCc3ccc(Cl)cc3)cc4 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 04008002 44000008 20004108 10210e00 00041020 00104000 02040000 02003001 00000100 00000840 00210004 40008800 02804886 00010080 01020401 020c810c 00002000 02000002 00680000 00020200 40000000 08008120 20800000 00c49000 00102000 c0002000 00260040 80000000 00000304 00060008 40040000 00024200 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |