On Target NS3_HCV1A 0.24683544/CHEMBL4108323
For the given ligand XIE5-2-25, we have found in our database that, being scored 0.24683544, the most similar ligand is CHEMBL4108323. Check out the elaboration below.
| XIE5-2-25 (Given Ligand) | CHEMBL4108323 (Similar Ligand) |
|---|---|
| N=C(N)N/N=C/c3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cc(C(=O)c2c(Cl)ccc([C@H](N)C3CC3)c2F)ccc1C#N |
|
|
|
|
|
|
| 04008008 40000008 20000108 00210a00 00003000 00004000 02040000 81084000 00000100 00000843 00000000 40008800 82804086 00010080 01000001 02088008 00000000 02000000 00480400 00020200 00080000 08000120 40040002 08c01000 00002000 80002800 40060100 00000000 00000228 000e0208 40100800 00020000 | 00008044 43000808 2010010a 42010600 00001221 00000010 22000000 01001000 00000900 00880ec0 08100000 40808a00 02008866 21201004 01004001 28082008 03400200 03000000 00880400 00020201 00000502 18028300 01000400 10420014 00002000 a0000200 08040000 40800081 00000380 00068422 84040000 00020600 |