Created at: Last updated at: Current status:
|
Name | XRK3F2 |
2D and 3D depictions | |
SMILES | OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 |
Model downloads | |
Fingerprints |
Name | XIE5-1-23 |
2D and 3D depictions | |
SMILES | N=C(N)N/N=C/c3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 |
Model downloads | |
Fingerprints |
Name | XIE5-2-25 |
2D and 3D depictions | |
SMILES | N=C(N)N/N=C/c3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 |
Model downloads | |
Fingerprints |
Name | XRK3 |
2D and 3D depictions | |
SMILES | OCCNCc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 |
Model downloads | |
Fingerprints |
Name | XIE106 |
2D and 3D depictions | |
SMILES | Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 |
Model downloads | |
Fingerprints |