On Target NS3_HCV1A 0.22307692/CHEMBL4107993
For the given ligand XIE5-1-23, we have found in our database that, being scored 0.22307692, the most similar ligand is CHEMBL4107993. Check out the elaboration below.
| XIE5-1-23 (Given Ligand) | CHEMBL4107993 (Similar Ligand) |
|---|---|
| N=C(N)N/N=C/c3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CC[C@@H](N)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 04000008 40000008 20000108 00210a00 00003000 00004000 02040000 81084000 00000100 00000843 00000000 40008000 80804002 00010080 01000001 02088008 00000000 02000000 00480400 00020200 00080000 08000020 40040002 08c01000 00000000 80002800 40020100 00000000 00000228 000e0208 40100800 00000000 | 00000040 00000808 20100108 02010600 00001201 00020010 02040000 01001200 00000800 00088e40 08100000 40008200 00008842 00001000 01000001 08082008 03000200 02000000 00000400 00020001 00000100 18028200 01000000 12400014 00000000 e0000000 08320800 40800001 00000380 00068002 82040010 00000600 |