On Target PA_INFA 0.3140496/CHEMBL3600947
For the given ligand XIE106, we have found in our database that, being scored 0.3140496, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| XIE106 (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |