On Target PA_INFA 0.28181818/CHEMBL3600947
For the given ligand XRK3, we have found in our database that, being scored 0.28181818, the most similar ligand is CHEMBL3600947. Check out the elaboration below.
| XRK3 (Given Ligand) | CHEMBL3600947 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | O=C(COc1ccc(F)cc1)c1ccc(O)c(O)c1O |
|
|
|
|
|
|
| 04000008 44000008 20000108 00210600 00001080 00004000 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00010080 01000401 02088008 10000000 02000000 00480000 00020200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000000 00000300 00060008 40040000 00000200 | 04001001 42000808 20110109 02010200 00001041 02020010 02000000 00000240 00000000 00080840 08040000 4000c100 00808002 00001000 01040001 2008a008 08000000 82000000 04000000 00420a00 00000000 08020200 01001000 00400014 00000000 80000000 00120008 00000001 00000200 00028002 80000000 00000600 |