On Target PR_HIV1 0.19662921/CHEMBL510485
For the given ligand XRK3, we have found in our database that, being scored 0.19662921, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| XRK3 (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 04000008 44000008 20000108 00210600 00001080 00004000 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00010080 01000401 02088008 10000000 02000000 00480000 00020200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000000 00000300 00060008 40040000 00000200 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |