On Target NS5B_HCV1A 0.31724137/CHEMBL363650
For the given ligand XIE106, we have found in our database that, being scored 0.31724137, the most similar ligand is CHEMBL363650. Check out the elaboration below.
| XIE106 (Given Ligand) | CHEMBL363650 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | COc1ccc2c(O[C@H]3CC(C(=O)[C@@H](NC(=O)[C@@H](NC(C)=O)C4CCCCC4)C(C)C)[C@H](C(=O)CC4(C(=O)O)CC4)C3)ccnc2c1 |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 04050002 01003008 20104008 04010700 000c1000 02000000 06000000 20000008 00000000 000008c0 00200004 4001b000 0680883a 01c02001 91000041 000c200c 00800000 00000104 02602000 00060a01 40000000 38048e18 21800001 82100018 00000000 00000000 00000000 10000000 08000202 01060001 20064000 00202200 |