On Target NS5B_HCV1B 0.18181819/CHEMBL3645194
For the given ligand XIE5-2-25, we have found in our database that, being scored 0.18181819, the most similar ligand is CHEMBL3645194. Check out the elaboration below.
| XIE5-2-25 (Given Ligand) | CHEMBL3645194 (Similar Ligand) |
|---|---|
| N=C(N)N/N=C/c3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | CCN(c1cc2nn(-c3ccc(Cl)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 04008008 40000008 20000108 00210a00 00003000 00004000 02040000 81084000 00000100 00000843 00000000 40008800 82804086 00010080 01000001 02088008 00000000 02000000 00480400 00020200 00080000 08000120 40040002 08c01000 00002000 80002800 40060100 00000000 00000228 000e0208 40100800 00020000 | 0000c006 00805e08 20080902 41310e00 010c0000 00004042 02040000 02001408 00100900 000908c0 09312024 40118800 82008c27 01400201 800a0040 000e200c 04268000 02000604 08600008 00224201 c0100101 1c838f38 20800800 8360001c 02106080 c0000040 002f0080 8000108c 0c488104 0046004b c4048080 a01347e0 |