On Target RDRP_SARS2 0.12244898/CHEMBL4065616
For the given ligand XIE5-1-23, we have found in our database that, being scored 0.12244898, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| XIE5-1-23 (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| N=C(N)N/N=C/c3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 04000008 40000008 20000108 00210a00 00003000 00004000 02040000 81084000 00000100 00000843 00000000 40008000 80804002 00010080 01000001 02088008 00000000 02000000 00480400 00020200 00080000 08000020 40040002 08c01000 00000000 80002800 40020100 00000000 00000228 000e0208 40100800 00000000 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |