On Target NSP15_SARS 0.22988506/CHEMBL471187
For the given ligand XIE5-1-23, we have found in our database that, being scored 0.22988506, the most similar ligand is CHEMBL471187. Check out the elaboration below.
| XIE5-1-23 (Given Ligand) | CHEMBL471187 (Similar Ligand) |
|---|---|
| N=C(N)N/N=C/c3ccc(OCc1ccccc1)c(OCc2ccccc2)c3 | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(O)cc2O3)c1 |
|
|
|
|
|
|
| 04000008 40000008 20000108 00210a00 00003000 00004000 02040000 81084000 00000100 00000843 00000000 40008000 80804002 00010080 01000001 02088008 00000000 02000000 00480400 00020200 00080000 08000020 40040002 08c01000 00000000 80002800 40020100 00000000 00000228 000e0208 40100800 00000000 | 00000001 00000008 20000008 00000200 00001000 00000000 42000000 00000000 00100000 00000840 00000000 00008800 00004002 00000000 01000001 00008008 00000000 00000004 00002000 00020800 00400000 08000100 00000000 00000000 00000000 20000000 00080000 00200000 80000200 00020008 00000400 02000000 |