On Target NP_HCoV-OC43 0.120300755/CHEMBL3233481
For the given ligand XIE106, we have found in our database that, being scored 0.120300755, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| XIE106 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |