On Target NP_HCoV-OC43 0.066176474/CHEMBL3233481
For the given ligand XIE5-2-25, we have found in our database that, being scored 0.066176474, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| XIE5-2-25 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| N=C(N)N/N=C/c3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 04008008 40000008 20000108 00210a00 00003000 00004000 02040000 81084000 00000100 00000843 00000000 40008800 82804086 00010080 01000001 02088008 00000000 02000000 00480400 00020200 00080000 08000120 40040002 08c01000 00002000 80002800 40060100 00000000 00000228 000e0208 40100800 00020000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |