On Target PLP_SARS 0.35384616/CHEMBL222735
For the given ligand XIE5-2-25, we have found in our database that, being scored 0.35384616, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| XIE5-2-25 (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| N=C(N)N/N=C/c3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 04008008 40000008 20000108 00210a00 00003000 00004000 02040000 81084000 00000100 00000843 00000000 40008800 82804086 00010080 01000001 02088008 00000000 02000000 00480400 00020200 00080000 08000120 40040002 08c01000 00002000 80002800 40060100 00000000 00000228 000e0208 40100800 00020000 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |