On Target NS3_HCV1A 0.33333334/CHEMBL4111820
For the given ligand Amodiaquine, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL4111820. Check out the elaboration below.
| Amodiaquine (Given Ligand) | CHEMBL4111820 (Similar Ligand) |
|---|---|
| CCN(CC)Cc3cc(Nc1ccnc2cc(Cl)ccc12)ccc3O | CC[C@@H](NCCC(N)=O)c1ccc(Cl)c(C(=O)c2cccnc2)c1F |
|
|
|
|
|
|
| 10018002 00000008 20004100 00010600 000c0000 08000000 0a008010 02001400 00802000 00100850 00300004 40008800 02000826 00400000 00000440 0004200c 00040000 02000000 08200002 00020000 41000000 08048108 20800000 80400000 00046000 c0000000 02048000 80000080 00408100 00060000 04040000 00420240 | 080080c2 00804c00 00104100 02010610 00041201 00000010 30002000 03001000 00400800 00080f40 08300004 40009a00 0a008866 00001004 00000400 080c000c 03010200 03000004 00200410 00000201 c0000500 18068700 21800000 3040001c 00043000 e0000200 08040000 c0800181 00400180 00068012 a4040000 00022600 |